EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9NO4 |
| Net Charge | 0 |
| Average Mass | 207.185 |
| Monoisotopic Mass | 207.05316 |
| SMILES | Cc1c(O)ccc2c(O)c(N)c(=O)oc12 |
| InChI | InChI=1S/C10H9NO4/c1-4-6(12)3-2-5-8(13)7(11)10(14)15-9(4)5/h2-3,12-13H,11H2,1H3 |
| InChIKey | RYDWGVPXXFYEQD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-amino-4,7-dihydroxy-8-methylcoumarin (CHEBI:74154) has role metabolite (CHEBI:25212) |
| 3-amino-4,7-dihydroxy-8-methylcoumarin (CHEBI:74154) is a hydroxycoumarin (CHEBI:37912) |
| IUPAC Name |
|---|
| 3-amino-4,7-dihydroxy-8-methyl-2H-chromen-2-one |
| Synonym | Source |
|---|---|
| 3-Amino-4,7-dihydroxy-8-methylcoumarin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C12466 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:212872 | Reaxys |
| Citations |
|---|