EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O11 |
| Net Charge | 0 |
| Average Mass | 342.297 |
| Monoisotopic Mass | 342.11621 |
| SMILES | OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@](O)(CO)[C@H]2O)[C@H](O)[C@@H](O)[C@H]1O |
| WURCS | WURCS=2.0/2,2,1/[ha122h-2b_2-5][a2112h-1b_1-5]/1-2/a4-b1 |
| InChI | InChI=1S/C12H22O11/c13-1-4-6(16)7(17)8(18)11(21-4)22-9-5(2-14)23-12(20,3-15)10(9)19/h4-11,13-20H,1-3H2/t4-,5-,6+,7+,8-,9-,10+,11+,12-/m1/s1 |
| InChIKey | JCQLYHFGKNRPGE-FCVZTGTOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lactulose (CHEBI:6359) has role gastrointestinal drug (CHEBI:55324) |
| lactulose (CHEBI:6359) has role laxative (CHEBI:50503) |
| lactulose (CHEBI:6359) is a glycosylfructose (CHEBI:35378) |
| IUPAC Name |
|---|
| 4-O-β-D-galactopyranosyl-β-D-fructofuranose |
| INNs | Source |
|---|---|
| lactulosa | ChemIDplus |
| lactulose | ChemIDplus |
| lactulosum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-O-beta-D-Galactopyranosyl-D-fructofuranose | ChemIDplus |
| 4-O-beta-D-Galactopyranosyl-D-fructose | ChemIDplus |
| D-Lactulose | ChemIDplus |
| Lactulose | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| lactulose | UniProt |
| Citations |
|---|