EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:15472 - anthraniloyl-CoA
| Formula | C28H41N8O17P3S |
| Net Charge | 0 |
| Average Mass | 886.664 |
| Monoisotopic Mass | 886.15232 |
| SMILES | CC(C)(COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)c1ccccc1N |
| InChI | InChI=1S/C28H41N8O17P3S/c1-28(2,22(39)25(40)32-8-7-18(37)31-9-10-57-27(41)15-5-3-4-6-16(15)29)12-50-56(47,48)53-55(45,46)49-11-17-21(52-54(42,43)44)20(38)26(51-17)36-14-35-19-23(30)33-13-34-24(19)36/h3-6,13-14,17,20-22,26,38-39H,7-12,29H2,1-2H3,(H,31,37)(H,32,40)(H,45,46)(H,47,48)(H2,30,33,34)(H2,42,43,44)/t17-,20-,21-,22+,26-/m1/s1 |
| InChIKey | XLURBJBQJZCJHJ-TYHXJLICSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anthraniloyl-CoA (CHEBI:15472) has functional parent anthranilic acid (CHEBI:30754) |
| anthraniloyl-CoA (CHEBI:15472) has functional parent benzoyl-CoA (CHEBI:15515) |
| anthraniloyl-CoA (CHEBI:15472) is a benzoyl-CoAs (CHEBI:22736) |
| anthraniloyl-CoA (CHEBI:15472) is conjugate acid of anthraniloyl-CoA(4−) (CHEBI:57331) |
| Incoming Relation(s) |
| anthraniloyl-CoA(4−) (CHEBI:57331) is conjugate base of anthraniloyl-CoA (CHEBI:15472) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-4-{[3-({2-[(2-aminobenzoyl)sulfanyl]ethyl}amino)-3-oxopropyl]amino}-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| 2-Aminobenzoyl-CoA | KEGG COMPOUND |
| anthraniloyl-coenzyme A | ChEBI |
| anthranilyl-CoA | ChEBI |
| Anthranilyl-CoA | KEGG COMPOUND |
| anthranilyl-coenzyme A | ChEBI |
| Citations |
|---|