EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H56O3 |
| Net Charge | 0 |
| Average Mass | 584.885 |
| Monoisotopic Mass | 584.42295 |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/[C@@]23O[C@]2(C)C[C@@H](O)CC3(C)C)C(C)(C)C[C@H](O)C1 |
| InChI | InChI=1S/C40H56O3/c1-29(17-13-19-31(3)21-22-36-33(5)25-34(41)26-37(36,6)7)15-11-12-16-30(2)18-14-20-32(4)23-24-40-38(8,9)27-35(42)28-39(40,10)43-40/h11-24,34-35,41-42H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,22-21+,24-23+,29-15+,30-16+,31-19+,32-20+/t34-,35+,39-,40+/m1/s1 |
| InChIKey | OFNSUWBAQRCHAV-OYQUVCAXSA-N |
| Roles Classification |
|---|
| Biological Roles: | biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| antheraxanthin (CHEBI:27867) has role biological pigment (CHEBI:26130) |
| antheraxanthin (CHEBI:27867) has role marine metabolite (CHEBI:76507) |
| antheraxanthin (CHEBI:27867) has role plant metabolite (CHEBI:76924) |
| antheraxanthin (CHEBI:27867) is a epoxycarotenol (CHEBI:35307) |
| IUPAC Name |
|---|
| (3R,3'S,5'R,6'S)-5',6'-dihydro-5',6'-epoxy-β,β-carotene-3,3'-diol |
| Synonyms | Source |
|---|---|
| 5,6-epoxy-5,6-dihydro-β,β-carotene-3,3'-diol | ChEBI |
| Antheraxanthin | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| all-trans-antheraxanthin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003760 | KNApSAcK |
| C08579 | KEGG COMPOUND |
| CPD1F-131 | MetaCyc |
| HMDB0035831 | HMDB |
| LMPR01070262 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:101042 | Reaxys |
| CAS:640-03-9 | KEGG COMPOUND |
| CAS:640-03-9 | ChemIDplus |
| Citations |
|---|