EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30N8O9 |
| Net Charge | 0 |
| Average Mass | 574.551 |
| Monoisotopic Mass | 574.21357 |
| SMILES | Nc1nc2c(c(=O)n1)NC(CNc1ccc(C(=O)N[C@@H](CCC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O)cc1)CN2 |
| InChI | InChI=1S/C24H30N8O9/c25-24-31-19-18(21(37)32-24)28-13(10-27-19)9-26-12-3-1-11(2-4-12)20(36)30-15(23(40)41)5-7-16(33)29-14(22(38)39)6-8-17(34)35/h1-4,13-15,26,28H,5-10H2,(H,29,33)(H,30,36)(H,34,35)(H,38,39)(H,40,41)(H4,25,27,31,32,37)/t13?,14-,15-/m0/s1 |
| InChIKey | ZAOGJXDWOQXFBW-FGRDXJNISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,6,7,8-tetrahydrofolyl-L-glutamic acid (CHEBI:27650) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 5,6,7,8-tetrahydrofolyl-L-glutamic acid (CHEBI:27650) has role mouse metabolite (CHEBI:75771) |
| 5,6,7,8-tetrahydrofolyl-L-glutamic acid (CHEBI:27650) is a tetrahydrofolyl glutamate (CHEBI:26908) |
| IUPAC Name |
|---|
| N-[(4-{[(2-amino-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl)methyl]amino}phenyl)carbonyl]-L-γ-glutamyl-L-glutamic acid |
| Synonyms | Source |
|---|---|
| Tetrahydrofolyl-[Glu](2) | KEGG COMPOUND |
| THF-L-glutamate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C09332 | KEGG COMPOUND |