EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H20NO6P |
| Net Charge | 0 |
| Average Mass | 257.223 |
| Monoisotopic Mass | 257.10282 |
| SMILES | C[N+](C)(C)CCOP(=O)([O-])OC[C@H](O)CO |
| InChI | InChI=1S/C8H20NO6P/c1-9(2,3)4-5-14-16(12,13)15-7-8(11)6-10/h8,10-11H,4-7H2,1-3H3/t8-/m1/s1 |
| InChIKey | SUHOQUVVVLNYQR-MRVPVSSYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| choline alfoscerate (CHEBI:16870) has role Escherichia coli metabolite (CHEBI:76971) |
| choline alfoscerate (CHEBI:16870) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| choline alfoscerate (CHEBI:16870) has role human metabolite (CHEBI:77746) |
| choline alfoscerate (CHEBI:16870) has role hypoglycemic agent (CHEBI:35526) |
| choline alfoscerate (CHEBI:16870) has role mouse metabolite (CHEBI:75771) |
| choline alfoscerate (CHEBI:16870) has role neuroprotective agent (CHEBI:63726) |
| choline alfoscerate (CHEBI:16870) has role parasympatholytic (CHEBI:50370) |
| choline alfoscerate (CHEBI:16870) is a sn-glycerol 3-phosphates (CHEBI:26706) |
| choline alfoscerate (CHEBI:16870) is a phosphocholines (CHEBI:36700) |
| IUPAC Names |
|---|
| 2-{[(2R)-2,3-dihydroxypropoxy](hydroxy)phosphoryloxy}-N,N,N-trimethylethanaminium |
| (2R)-2,3-dihydroxypropyl 2-(trimethylazaniumyl)ethyl phosphate |
| INNs | Source |
|---|---|
| alfoscerate de choline | ChemIDplus |
| alfoscerato de colina | ChemIDplus |
| choline alfoscerate | KEGG DRUG |
| choline alfoscerate | ChemIDplus |
| cholini alfosceras | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2R)-2,3-dihydroxypropyl 2-(trimethylammonio)ethyl phosphate | IUPAC |
| alpha-Glycerophosphorylcholine | HMDB |
| Alpha-glycerylphosphorylcholine | ChEMBL |
| Choline alphoscerate | ChemIDplus |
| Choline glycerophosphate | ChemIDplus |
| Cholini glycerophosphas | ChemIDplus |
| Brand Name | Source |
|---|---|
| L-.alpha.-glycerylphosphorylcholine | ChEMBL |
| UniProt Name | Source |
|---|---|
| sn-glycerol 3-phosphocholine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 627 | DrugCentral |
| Alpha-GPC | Wikipedia |
| C00670 | KEGG COMPOUND |
| CH5 | PDBeChem |
| D07349 | KEGG DRUG |
| DB04660 | DrugBank |
| HMDB0000086 | HMDB |
| L-1-GLYCERO-PHOSPHORYLCHOLINE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3908444 | Reaxys |
| Beilstein:6062450 | Beilstein |
| CAS:28319-77-9 | KEGG COMPOUND |
| CAS:28319-77-9 | KEGG DRUG |
| CAS:28319-77-9 | ChemIDplus |
| Citations |
|---|