EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O16 |
| Net Charge | 0 |
| Average Mass | 610.521 |
| Monoisotopic Mass | 610.15338 |
| SMILES | C[C@@H]1O[C@@H](OC[C@H]2O[C@@H](Oc3c(-c4ccc(O)c(O)c4)oc4cc(O)cc(O)c4c3=O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H30O16/c1-8-17(32)20(35)22(37)26(40-8)39-7-15-18(33)21(36)23(38)27(42-15)43-25-19(34)16-13(31)5-10(28)6-14(16)41-24(25)9-2-3-11(29)12(30)4-9/h2-6,8,15,17-18,20-23,26-33,35-38H,7H2,1H3/t8-,15+,17-,18+,20+,21-,22+,23+,26+,27-/m0/s1 |
| InChIKey | IKGXIBQEEMLURG-NVPNHPEKSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Physalis longifolia (ncbitaxon:161495) | aerial part (BTO:0001658) | PubMed (22098611) | CH2Cl2-MeOH(1:1) extract of the air-dried aerial parts |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rutin (CHEBI:28527) has role antioxidant (CHEBI:22586) |
| rutin (CHEBI:28527) has role metabolite (CHEBI:25212) |
| rutin (CHEBI:28527) is a disaccharide derivative (CHEBI:63353) |
| rutin (CHEBI:28527) is a quercetin O-glucoside (CHEBI:64621) |
| rutin (CHEBI:28527) is a rutinoside (CHEBI:26587) |
| rutin (CHEBI:28527) is a tetrahydroxyflavone (CHEBI:38684) |
| Incoming Relation(s) |
| rutin hydrate (CHEBI:232410) has part rutin (CHEBI:28527) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-4H-chromen-3-yl 6-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 3-[[6-O-(6-Deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranosyl]oxy]-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-1-benzopyran-4-one | KEGG COMPOUND |
| 3-Rhamnoglucosylquercetin | ChemIDplus |
| 3-Rutinosyl quercetin | ChemIDplus |
| Phytomelin | KEGG COMPOUND |
| Quercetin 3-rutinoside | KEGG COMPOUND |
| Quercetin-3-rutinoside | KEGG COMPOUND |
| Citations |
|---|