EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H32MgN4O5 |
| Net Charge | 0 |
| Average Mass | 612.969 |
| Monoisotopic Mass | 612.22231 |
| SMILES | C=Cc1c(C)c2[n]3c1=CC1=[N+]4C(=Cc5c(C)c6c7[n]5[Mg-2]34[N+]3=C(C=2)C(C)=C(CCC(=O)O)C3=C7[C@@H](C(=O)OC)C6=O)C(CC)=C1C |
| InChI | InChI=1S/C35H34N4O5.Mg/c1-8-19-15(3)22-12-24-17(5)21(10-11-28(40)41)32(38-24)30-31(35(43)44-7)34(42)29-18(6)25(39-33(29)30)14-27-20(9-2)16(4)23(37-27)13-26(19)36-22;/h8,12-14,31H,1,9-11H2,2-7H3,(H3,36,37,38,39,40,41,42);/q;+2/p-2/b22-12-,23-13-,24-12-,25-14-,26-13-,27-14-,32-30-;/t31-;/m1./s1 |
| InChIKey | QBPCOMNNISRCTC-KKNVGXODSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| protochlorophyllide (CHEBI:16673) has role biological pigment (CHEBI:26130) |
| protochlorophyllide (CHEBI:16673) is a protochlorophyllides (CHEBI:26354) |
| protochlorophyllide (CHEBI:16673) is conjugate acid of protochlorophyllide(1−) (CHEBI:57855) |
| Incoming Relation(s) |
| protochlorophyllide(1−) (CHEBI:57855) is conjugate base of protochlorophyllide (CHEBI:16673) |
| IUPAC Name |
|---|
| {3-[(21R)-9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-3,4-didehydrophorbin-3-yl-κ4N23,N24,N25,N26]propanoato(2−)}magnesium |
| Synonyms | Source |
|---|---|
| Protochlorophyllide | KEGG COMPOUND |
| protochlorophyllide a | ChemIDplus |
| {3-[(21R)-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-9-vinyl-3,4-didehydrophorbin-3-yl-κ4N23,N24,N25,N26]propanoato(2−)}magnesium | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| C02880 | KEGG COMPOUND |
| Protochlorophyllide | Wikipedia |
| PMR | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7511448 | Beilstein |
| Reaxys:19512139 | Reaxys |
| CAS:20369-67-9 | ChemIDplus |
| CAS:20369-67-9 | KEGG COMPOUND |
| Citations |
|---|