EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7O3 |
| Net Charge | -1 |
| Average Mass | 163.152 |
| Monoisotopic Mass | 163.04007 |
| SMILES | O=C([O-])C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C9H8O3/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,11,12)/p-1 |
| InChIKey | BTNMPGBKDVTSJY-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| Application: | chromogenic compound Colourless, endogenous or exogenous pigment precursors that may be transformed by biological mechanisms into coloured compounds. They are used in biochemical assays and in diagnosis as indicators, particularly in the form of enzyme substrates. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| keto-phenylpyruvate (CHEBI:18005) has functional parent pyruvate (CHEBI:15361) |
| keto-phenylpyruvate (CHEBI:18005) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| keto-phenylpyruvate (CHEBI:18005) has role chromogenic compound (CHEBI:75050) |
| keto-phenylpyruvate (CHEBI:18005) has role human metabolite (CHEBI:77746) |
| keto-phenylpyruvate (CHEBI:18005) is a 2-oxo monocarboxylic acid anion (CHEBI:35179) |
| keto-phenylpyruvate (CHEBI:18005) is a phenylpyruvate (CHEBI:26008) |
| keto-phenylpyruvate (CHEBI:18005) is conjugate base of keto-phenylpyruvic acid (CHEBI:30851) |
| Incoming Relation(s) |
| keto-phenylpyruvic acid (CHEBI:30851) is conjugate acid of keto-phenylpyruvate (CHEBI:18005) |
| IUPAC Name |
|---|
| 2-oxo-3-phenylpropanoate |
| Synonyms | Source |
|---|---|
| 3-(4-hydroxyphenyl)pyruvate | ChEBI |
| 3-phenyl-2-oxopropanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| 3-phenylpyruvate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00166 | KEGG COMPOUND |
| PHENYL-PYRUVATE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3944391 | Beilstein |
| Gmelin:847922 | Gmelin |