EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8N4O4 |
| Net Charge | 0 |
| Average Mass | 176.132 |
| Monoisotopic Mass | 176.05455 |
| SMILES | NC(=O)NC(NC(N)=O)C(=O)O |
| InChI | InChI=1S/C4H8N4O4/c5-3(11)7-1(2(9)10)8-4(6)12/h1H,(H,9,10)(H3,5,7,11)(H3,6,8,12) |
| InChIKey | NUCLJNSWZCHRKL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| allantoic acid (CHEBI:30837) has role mouse metabolite (CHEBI:75771) |
| allantoic acid (CHEBI:30837) has role plant metabolite (CHEBI:76924) |
| allantoic acid (CHEBI:30837) is a ureas (CHEBI:47857) |
| allantoic acid (CHEBI:30837) is conjugate acid of allantoate (CHEBI:17536) |
| Incoming Relation(s) |
| allantoate (CHEBI:17536) is conjugate base of allantoic acid (CHEBI:30837) |
| IUPAC Name |
|---|
| bis(carbamoylamino)acetic acid |
| Synonyms | Source |
|---|---|
| Allantoic acid | KEGG COMPOUND |
| bis[(aminocarbonyl)amino]acetic acid | ChEBI |
| diureidoacetic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1AL | PDBeChem |
| ALLANTOATE | MetaCyc |
| Allantoic_acid | Wikipedia |
| C00007470 | KNApSAcK |
| C00499 | KEGG COMPOUND |
| HMDB0001209 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1790227 | Reaxys |
| Gmelin:240954 | Gmelin |
| CAS:99-16-1 | KEGG COMPOUND |
| CAS:99-16-1 | ChemIDplus |
| Citations |
|---|