EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O10 |
| Net Charge | 0 |
| Average Mass | 434.397 |
| Monoisotopic Mass | 434.12130 |
| SMILES | O=C1C[C@@H](c2ccc(O)cc2)Oc2cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc(O)c21 |
| InChI | InChI=1S/C21H22O10/c22-8-16-18(26)19(27)20(28)21(31-16)29-11-5-12(24)17-13(25)7-14(30-15(17)6-11)9-1-3-10(23)4-2-9/h1-6,14,16,18-24,26-28H,7-8H2/t14-,16+,18+,19-,20+,21+/m0/s1 |
| InChIKey | DLIKSSGEMUFQOK-SFTVRKLSSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naringenin 7-O-β-D-glucoside (CHEBI:28327) has functional parent (S)-naringenin (CHEBI:17846) |
| naringenin 7-O-β-D-glucoside (CHEBI:28327) has role antibacterial agent (CHEBI:33282) |
| naringenin 7-O-β-D-glucoside (CHEBI:28327) has role antilipemic drug (CHEBI:35679) |
| naringenin 7-O-β-D-glucoside (CHEBI:28327) has role hypoglycemic agent (CHEBI:35526) |
| naringenin 7-O-β-D-glucoside (CHEBI:28327) has role metabolite (CHEBI:25212) |
| naringenin 7-O-β-D-glucoside (CHEBI:28327) is a (2S)-flavan-4-one (CHEBI:140377) |
| naringenin 7-O-β-D-glucoside (CHEBI:28327) is a 4'-hydroxyflavanones (CHEBI:140331) |
| naringenin 7-O-β-D-glucoside (CHEBI:28327) is a dihydroxyflavanone (CHEBI:38749) |
| naringenin 7-O-β-D-glucoside (CHEBI:28327) is a flavanone 7-O-β-D-glucoside (CHEBI:13637) |
| naringenin 7-O-β-D-glucoside (CHEBI:28327) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| (2S)-5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-3,4-dihydro-2H-chromen-7-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| (S)-7-(β-D-glucopyranosyloxy)-2,3-dihydro-5-hydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one | ChemIDplus |
| Naringenin 7-O-beta-D-glucoside | KEGG COMPOUND |
| Prunin | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (2S)-naringenin 7-O-β-D-glucoside | UniProt |
| Citations |
|---|