EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H28O3 |
| Net Charge | 0 |
| Average Mass | 280.408 |
| Monoisotopic Mass | 280.20384 |
| SMILES | CC[C@]1(C)O[C@@H]1CC/C(C)=C/CC/C(C)=C/C(=O)OC |
| InChI | InChI=1S/C17H28O3/c1-6-17(4)15(20-17)11-10-13(2)8-7-9-14(3)12-16(18)19-5/h8,12,15H,6-7,9-11H2,1-5H3/b13-8+,14-12+/t15-,17+/m1/s1 |
| InChIKey | CPVQJXZBSGXTGJ-TZDLBHCHSA-N |
| Roles Classification |
|---|
| Biological Roles: | hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| juvenile hormone II (CHEBI:15581) is a enoate ester (CHEBI:51702) |
| juvenile hormone II (CHEBI:15581) is a epoxide (CHEBI:32955) |
| juvenile hormone II (CHEBI:15581) is a fatty acid methyl ester (CHEBI:4986) |
| juvenile hormone II (CHEBI:15581) is a juvenile hormone (CHEBI:24943) |
| IUPAC Names |
|---|
| methyl (2E,6E,10R,11S)-10,11-epoxy-3,7,11-trimethyltrideca-2,6-dienoate |
| methyl (2E,6E)-9-[(2R,3S)-3-ethyl-3-methyloxiran-2-yl]-3,7-dimethylnona-2,6-dienoate |
| Synonyms | Source |
|---|---|
| (10R,11S)-(+)-Juvenile hormone II | ChemIDplus |
| (10R,11S)-Juvenile hormone II | ChemIDplus |
| 12-Homojuvenate | ChemIDplus |
| Cecropia juvenile hormone II | ChemIDplus |
| cis-10,11-Epoxy-11-ethyl-3,7-dimethyl-2-trans-6-trans-tridecadienoic acid methyl ester | ChemIDplus |
| JH II | ChemIDplus |
| UniProt Name | Source |
|---|---|
| juvenile hormone II | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C04867 | KEGG COMPOUND |
| LMFA01070020 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1685515 | Reaxys |
| CAS:34218-61-6 | ChemIDplus |
| Citations |
|---|