EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O5 |
| Net Charge | 0 |
| Average Mass | 352.471 |
| Monoisotopic Mass | 352.22497 |
| SMILES | CCCCCC(=O)CC[C@H]1[C@H](O)CC(=O)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,16-17,19,23H,2-3,5-6,8-14H2,1H3,(H,24,25)/b7-4-/t16-,17-,19-/m1/s1 |
| InChIKey | CUJMXIQZWPZMNQ-XYYGWQPLSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13,14-dihydro-15-oxo-prostaglandin E2 (CHEBI:15550) has functional parent prostaglandin E2 (CHEBI:15551) |
| 13,14-dihydro-15-oxo-prostaglandin E2 (CHEBI:15550) is a prostaglandins E (CHEBI:26338) |
| 13,14-dihydro-15-oxo-prostaglandin E2 (CHEBI:15550) is conjugate acid of 13,14-dihydro-15-oxo-prostaglandin E2(1−) (CHEBI:57402) |
| Incoming Relation(s) |
| 13,14-dihydro-15-oxo-prostaglandin E2(1−) (CHEBI:57402) is conjugate base of 13,14-dihydro-15-oxo-prostaglandin E2 (CHEBI:15550) |
| IUPAC Name |
|---|
| (5Z)-11α-hydroxy-9,15-dioxoprost-5-enoic acid |
| Synonyms | Source |
|---|---|
| 13,14-dihydro-15-keto-PGE2 | LIPID MAPS |
| 13,14-Dihydro-15-keto-PGE2 | ChemIDplus |
| 13,14-Dihydro-15-ketoprostaglandin E2 | ChemIDplus |
| 15-Keto-13,14-dihydro-PGE2 | ChemIDplus |
| 15-Keto-13,14-dihydroprostaglandin E2 | ChemIDplus |
| (5Z)-(15S)-11alpha-Hydroxy-9,15-dioxoprostanoate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C04671 | KEGG COMPOUND |
| LMFA03010031 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:363-23-5 | ChemIDplus |