EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10NO6P |
| Net Charge | 0 |
| Average Mass | 247.143 |
| Monoisotopic Mass | 247.02457 |
| SMILES | [H]C(=O)c1c(COP(=O)(O)O)cnc(C)c1O |
| InChI | InChI=1S/C8H10NO6P/c1-5-8(11)7(3-10)6(2-9-5)4-15-16(12,13)14/h2-3,11H,4H2,1H3,(H2,12,13,14) |
| InChIKey | NGVDGCNFYWLIFO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor A DNA polymerase inhibitor that interferes with the action of a DNA-directed DNA polymerase (EC 2.7.7.7). coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. |
| Applications: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyridoxal 5'-phosphate (CHEBI:18405) has functional parent pyridoxal (CHEBI:17310) |
| pyridoxal 5'-phosphate (CHEBI:18405) has role Escherichia coli metabolite (CHEBI:76971) |
| pyridoxal 5'-phosphate (CHEBI:18405) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| pyridoxal 5'-phosphate (CHEBI:18405) has role coenzyme (CHEBI:23354) |
| pyridoxal 5'-phosphate (CHEBI:18405) has role cofactor (CHEBI:23357) |
| pyridoxal 5'-phosphate (CHEBI:18405) has role EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor (CHEBI:131699) |
| pyridoxal 5'-phosphate (CHEBI:18405) has role human metabolite (CHEBI:77746) |
| pyridoxal 5'-phosphate (CHEBI:18405) has role mouse metabolite (CHEBI:75771) |
| pyridoxal 5'-phosphate (CHEBI:18405) is a methylpyridines (CHEBI:25340) |
| pyridoxal 5'-phosphate (CHEBI:18405) is a monohydroxypyridine (CHEBI:38182) |
| pyridoxal 5'-phosphate (CHEBI:18405) is a pyridinecarbaldehyde (CHEBI:38187) |
| pyridoxal 5'-phosphate (CHEBI:18405) is a vitamin B6 phosphate (CHEBI:36970) |
| pyridoxal 5'-phosphate (CHEBI:18405) is conjugate acid of pyridoxal 5'-phosphate(2−) (CHEBI:597326) |
| Incoming Relation(s) |
| (2R,3R,4S,5R,6R)-3,4-dihydroxy-5-{[(1E)-{3-hydroxy-2-methyl-5-[(phosphonooxy)methyl]pyridin-4-yl}methylidene]amino}-6-methyltetrahydro-2H-pyran-2-yl [(2R,3S,5R)-3-hydroxy-5-(thymin-1-yl)tetrahydrofuran-2-yl]methyl dihydrogen diphosphate (CHEBI:47689) has functional parent pyridoxal 5'-phosphate (CHEBI:18405) |
| 5'-phosphopyridoxal-6-azobenzene-2,4-disulfonic acid (CHEBI:34941) has functional parent pyridoxal 5'-phosphate (CHEBI:18405) |
| pyridoxal 5'-phosphate(2−) (CHEBI:597326) is conjugate base of pyridoxal 5'-phosphate (CHEBI:18405) |
| IUPAC Name |
|---|
| (4-formyl-5-hydroxy-6-methylpyridin-3-yl)methyl dihydrogen phosphate |
| Synonyms | Source |
|---|---|
| 3-hydroxy-2-methyl-5-[(phosphonooxy)methyl]-4-pyridinecarboxaldehyde | ChEBI |
| 3-hydroxy-5-(hydroxymethyl)-2-methylisonicotinaldehyde 5-phosphate | ChEBI |
| codecarboxylase | ChEBI |
| Phosphoric acid mono-(4-formyl-5-hydroxy-6-methyl-pyridin-3-ylmethyl) ester | ChEMBL |
| PLP | KEGG COMPOUND |
| pyridoxal 5'-(dihydrogen phosphate) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 3506 | DrugCentral |
| C00007503 | KNApSAcK |
| C00018 | KEGG COMPOUND |
| C00018 | KEGG COMPOUND |
| DB00114 | DrugBank |
| HMDB0001491 | HMDB |
| PLP | PDBeChem |
| Pyridoxal_phosphate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:234749 | Reaxys |
| Gmelin:465416 | Gmelin |
| CAS:54-47-7 | ChemIDplus |
| CAS:54-47-7 | KEGG COMPOUND |
| Citations |
|---|