EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22O8 |
| Net Charge | 0 |
| Average Mass | 342.344 |
| Monoisotopic Mass | 342.13147 |
| SMILES | COc1cc(/C=C/CO)ccc1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H22O8/c1-22-11-7-9(3-2-6-17)4-5-10(11)23-16-15(21)14(20)13(19)12(8-18)24-16/h2-5,7,12-21H,6,8H2,1H3/b3-2+/t12-,13-,14+,15-,16-/m1/s1 |
| InChIKey | SFLMUHDGSQZDOW-FAOXUISGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coniferin (CHEBI:16220) has functional parent coniferol (CHEBI:17745) |
| coniferin (CHEBI:16220) has role plant metabolite (CHEBI:76924) |
| coniferin (CHEBI:16220) is a aromatic ether (CHEBI:35618) |
| coniferin (CHEBI:16220) is a cinnamyl alcohol β-D-glucoside (CHEBI:20346) |
| coniferin (CHEBI:16220) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| 4-(3-hydroxyprop-1-en-1-yl)-2-methoxyphenyl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| Coniferin | KEGG COMPOUND |
| Coniferyl alcohol beta-D-glucoside | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 4-O-(β-D-glucosyl)-(E)-coniferol | UniProt |
| Citations |
|---|