EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H36O4 |
| Net Charge | 0 |
| Average Mass | 316.482 |
| Monoisotopic Mass | 316.26136 |
| SMILES | CCCCCCCCC(O)C(O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H36O4/c1-2-3-4-5-7-10-13-16(19)17(20)14-11-8-6-9-12-15-18(21)22/h16-17,19-20H,2-15H2,1H3,(H,21,22) |
| InChIKey | VACHUYIREGFMSP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9,10-dihydroxyoctadecanoic acid (CHEBI:28724) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| 9,10-dihydroxyoctadecanoic acid (CHEBI:28724) is a hydroxyoctadecanoic acid (CHEBI:24747) |
| 9,10-dihydroxyoctadecanoic acid (CHEBI:28724) is conjugate acid of 9,10-dihydroxystearate (CHEBI:85197) |
| Incoming Relation(s) |
| (S,S)-9,10-dihydroxyoctadecanoic acid (CHEBI:49254) is a 9,10-dihydroxyoctadecanoic acid (CHEBI:28724) |
| 9,10-dihydroxystearate (CHEBI:85197) is conjugate base of 9,10-dihydroxyoctadecanoic acid (CHEBI:28724) |
| IUPAC Name |
|---|
| 9,10-dihydroxyoctadecanoic acid |
| Synonyms | Source |
|---|---|
| 9,10-DHSA | ChEBI |
| 9,10-dihydroxystearic acid | ChEBI |
| 9,10-Dihydroxystearinsäure | ChemIDplus |
| 9,10-diOH 18:0 | ChEBI |
| 9,10-diOH C18:0 | ChEBI |
| DHSA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA02000142 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1728015 | Reaxys |
| Gmelin:383116 | Gmelin |
| CAS:120-87-6 | ChemIDplus |
| Citations |
|---|