EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12O2 |
| Net Charge | 0 |
| Average Mass | 188.226 |
| Monoisotopic Mass | 188.08373 |
| SMILES | O[C@@H]1C(c2ccccc2)=CC=C[C@@H]1O |
| InChI | InChI=1S/C12H12O2/c13-11-8-4-7-10(12(11)14)9-5-2-1-3-6-9/h1-8,11-14H/t11-,12+/m0/s1 |
| InChIKey | UMAHGMFKBJHGME-NWDGAFQWSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S,2R)-3-phenylcyclohexa-3,5-diene-1,2-diol (CHEBI:32922) is a cis-3-phenylcyclohexa-3,5-diene-1,2-diol (CHEBI:15599) |
| (1S,2R)-3-phenylcyclohexa-3,5-diene-1,2-diol (CHEBI:32922) is enantiomer of (1R,2S)-3-phenylcyclohexa-3,5-diene-1,2-diol (CHEBI:35440) |
| Incoming Relation(s) |
| (1S,2R)-3-(4-chlorophenyl)cyclohexa-3,5-diene-1,2-diol (CHEBI:28974) has functional parent (1S,2R)-3-phenylcyclohexa-3,5-diene-1,2-diol (CHEBI:32922) |
| (1R,2S)-3-phenylcyclohexa-3,5-diene-1,2-diol (CHEBI:35440) is enantiomer of (1S,2R)-3-phenylcyclohexa-3,5-diene-1,2-diol (CHEBI:32922) |
| IUPAC Name |
|---|
| (1S,2R)-3-phenylcyclohexa-3,5-diene-1,2-diol |
| Synonyms | Source |
|---|---|
| cis-2,3-dihydro-2,3-dihydroxybiphenyl | UM-BBD |
| cis-2,3-dihydroxy-4-phenylhexa-4,6-diene | UM-BBD |
| (1S,2R)-3-Phenylcyclohexa-3,5-diene-1,2-diol | KEGG COMPOUND |
| cis-3-Phenylcyclohexa-3,5-diene-1,2-diol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (2R,3S)-3-phenylcyclohexa-3,5-diene-1,2-diol | UniProt |