EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N4O3 |
| Net Charge | 0 |
| Average Mass | 240.263 |
| Monoisotopic Mass | 240.12224 |
| SMILES | Cn1cncc1C[C@H](NC(=O)CCN)C(=O)O |
| InChI | InChI=1S/C10H16N4O3/c1-14-6-12-5-7(14)4-8(10(16)17)13-9(15)2-3-11/h5-6,8H,2-4,11H2,1H3,(H,13,15)(H,16,17)/t8-/m0/s1 |
| InChIKey | MYYIAHXIVFADCU-QMMMGPOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos taurus (ncbitaxon:9913) | - | PubMed (24211545) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anserine (CHEBI:18323) has role animal metabolite (CHEBI:75767) |
| anserine (CHEBI:18323) has role mouse metabolite (CHEBI:75771) |
| anserine (CHEBI:18323) is a dipeptide (CHEBI:46761) |
| anserine (CHEBI:18323) is a β-alanine derivative (CHEBI:22823) |
| anserine (CHEBI:18323) is tautomer of anserine zwitterion (CHEBI:58445) |
| Incoming Relation(s) |
| anserine zwitterion (CHEBI:58445) is tautomer of anserine (CHEBI:18323) |
| IUPAC Name |
|---|
| Nα-(β-alanyl)-Nπ-methylhistidine |
| Synonyms | Source |
|---|---|
| Anserine | KEGG COMPOUND |
| beta-Alanyl-N(pai)-methyl-L-histidine | KEGG COMPOUND |
| β-alanyl-3-methyl-L-histidine | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| C01262 | KEGG COMPOUND |
| CPD-401 | MetaCyc |
| HMDB0000194 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:89932 | Reaxys |
| CAS:584-85-0 | ChemIDplus |
| CAS:584-85-0 | KEGG COMPOUND |
| Citations |
|---|