EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N5O3 |
| Net Charge | 0 |
| Average Mass | 239.235 |
| Monoisotopic Mass | 239.10184 |
| SMILES | C[C@@H](O)[C@@H](O)C1=Nc2c(nc(N)nc2=O)NC1 |
| InChI | InChI=1S/C9H13N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h3,6,15-16H,2H2,1H3,(H4,10,11,13,14,17)/t3-,6-/m1/s1 |
| InChIKey | FEMXZDUTFRTWPE-AWFVSMACSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-erythro-7,8-dihydrobiopterin (CHEBI:15375) is a 7,8-dihydrobiopterin (CHEBI:64277) |
| D-erythro-7,8-dihydrobiopterin (CHEBI:15375) is enantiomer of L-erythro-7,8-dihydrobiopterin (CHEBI:43029) |
| Incoming Relation(s) |
| L-erythro-7,8-dihydrobiopterin (CHEBI:43029) is enantiomer of D-erythro-7,8-dihydrobiopterin (CHEBI:15375) |
| IUPAC Name |
|---|
| 2-amino-6-[(1S,2R)-1,2-dihydroxypropyl]-7,8-dihydropteridin-4(1H)-one |
| Synonym | Source |
|---|---|
| 7,8-Dihydrobiopterin | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| D-erythro-7,8-dihydrobiopterin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| DB04400 | DrugBank |