EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H44O7P2 |
| Net Charge | 0 |
| Average Mass | 518.568 |
| Monoisotopic Mass | 518.25623 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C25H44O7P2/c1-21(2)11-7-12-22(3)13-8-14-23(4)15-9-16-24(5)17-10-18-25(6)19-20-31-34(29,30)32-33(26,27)28/h11,13,15,17,19H,7-10,12,14,16,18,20H2,1-6H3,(H,29,30)(H2,26,27,28)/b22-13+,23-15+,24-17+,25-19+ |
| InChIKey | JMVSBFJBMXQNJW-GIXZANJISA-N |
| Roles Classification |
|---|
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| all-trans-pentaprenyl diphosphate (CHEBI:16818) is a pentaprenyl diphosphate (CHEBI:53048) |
| all-trans-pentaprenyl diphosphate (CHEBI:16818) is conjugate acid of all-trans-pentaprenyl diphosphate(3−) (CHEBI:57907) |
| Incoming Relation(s) |
| all-trans-pentaprenyl diphosphate(3−) (CHEBI:57907) is conjugate base of all-trans-pentaprenyl diphosphate (CHEBI:16818) |
| IUPAC Name |
|---|
| (2E,6E,10E,14E)-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaen-1-yl trihydrogen diphosphate |
| Synonyms | Source |
|---|---|
| 2-trans,6-trans,10-trans,14-trans-geranylfarnesyl diphosphate | ChEBI |
| (2E,6E,10E,14E)-geranylfarnesyl diphosphate | ChEBI |
| all-trans-Pentaprenyl diphosphate | KEGG COMPOUND |
| geranylfarnesyl diphosphate | KEGG COMPOUND |
| all-trans-farnesylgeranyl diphosphate | ChEBI |
| all-trans-farnesylgeranyl pyrophosphate | ChEBI |