EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H56O4 |
| Net Charge | 0 |
| Average Mass | 600.884 |
| Monoisotopic Mass | 600.41786 |
| SMILES | [H]C(=C=C1C(C)(C)C[C@H](O)C[C@@]1(C)O)/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/[C@@]12O[C@]1(C)C[C@@H](O)CC2(C)C |
| InChI | InChI=1S/C40H56O4/c1-29(17-13-19-31(3)21-22-35-36(5,6)25-33(41)27-38(35,9)43)15-11-12-16-30(2)18-14-20-32(4)23-24-40-37(7,8)26-34(42)28-39(40,10)44-40/h11-21,23-24,33-34,41-43H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,24-23+,29-15+,30-16+,31-19+,32-20+/t22-,33-,34-,38+,39+,40-/m0/s1 |
| InChIKey | PGYAYSRVSAJXTE-MTYISEJWSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| all-trans-neoxanthin (CHEBI:32446) has role biological pigment (CHEBI:26130) |
| all-trans-neoxanthin (CHEBI:32446) has role plant metabolite (CHEBI:76924) |
| all-trans-neoxanthin (CHEBI:32446) is a neoxanthin (CHEBI:25501) |
| IUPAC Names |
|---|
| (3S,5R,6R,3'S,5'R,6'S)-6,7-didehydro-5',6'-epoxy-5,6,5',6'-tetrahydro-β,β-carotene-3,5,3'-triol |
| (3S,3'S,5R,5'R,6R,6'S,8R)-6,7-didehydro-5,5',6,6'-tetrahydro-5',6'-epoxy-β,β-carotene-3,3',5-triol |
| Synonyms | Source |
|---|---|
| Neoxanthin | KEGG COMPOUND |
| all-trans-Neoxanthin | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| all-trans-neoxanthin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C08606 | KEGG COMPOUND |
| CPD1F-135 | MetaCyc |
| HMDB0003020 | HMDB |
| C13431 | KEGG COMPOUND |
| C00003780 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Beilstein:101197 | Beilstein |
| Reaxys:101197 | Reaxys |
| CAS:14660-91-4 | KEGG COMPOUND |
| CAS:14660-91-4 | ChemIDplus |
| Citations |
|---|