EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:27891 - S-sulfo-L-cysteine
| Formula | C3H7NO5S2 |
| Net Charge | 0 |
| Average Mass | 201.225 |
| Monoisotopic Mass | 200.97656 |
| SMILES | N[C@@H](CSS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C3H7NO5S2/c4-2(3(5)6)1-10-11(7,8)9/h2H,1,4H2,(H,5,6)(H,7,8,9)/t2-/m0/s1 |
| InChIKey | NOKPBJYHPHHWAN-REOHCLBHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-sulfo-L-cysteine (CHEBI:27891) has role human metabolite (CHEBI:77746) |
| S-sulfo-L-cysteine (CHEBI:27891) has role plant metabolite (CHEBI:76924) |
| S-sulfo-L-cysteine (CHEBI:27891) is a S-substituted L-cysteine (CHEBI:47910) |
| S-sulfo-L-cysteine (CHEBI:27891) is a organic thiosulfate (CHEBI:37996) |
| S-sulfo-L-cysteine (CHEBI:27891) is conjugate acid of S-sulfo-L-cysteinate(1−) (CHEBI:62225) |
| Incoming Relation(s) |
| S-sulfo-L-cysteinate(1−) (CHEBI:62225) is conjugate base of S-sulfo-L-cysteine (CHEBI:27891) |
| IUPAC Name |
|---|
| 3-(sulfosulfanyl)-L-alanine |
| Synonyms | Source |
|---|---|
| S-Sulfo-L-cysteine | KEGG COMPOUND |
| Cysteinyl-S-sulfonic acid | ChemIDplus |
| S-sulfocysteine | ChEBI |
| S-Sulfocysteine | ChemIDplus |
| Cysteine-S-sulfonate | ChemIDplus |
| Cysteine-S-sulfate | ChemIDplus |
| Citations |
|---|