EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13NO6 |
| Net Charge | 0 |
| Average Mass | 219.193 |
| Monoisotopic Mass | 219.07429 |
| SMILES | NC(CCOC(=O)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H13NO6/c9-5(8(13)14)3-4-15-7(12)2-1-6(10)11/h5H,1-4,9H2,(H,10,11)(H,13,14) |
| InChIKey | GNISQJGXJIDKDJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| o-succinylhomoserine (CHEBI:181442) is a homoserine derivative (CHEBI:24619) |
| Incoming Relation(s) |
| O-succinyl-L-homoserine (CHEBI:16160) is a o-succinylhomoserine (CHEBI:181442) |
| IUPAC Name |
|---|
| O-(3-carboxypropanoyl)homoserine |
| Synonyms | Source |
|---|---|
| 2-amino-4-(3-carboxypropanoyloxy)butanoic acid | ChEBI |
| 2-amino-4-[(3-carboxypropanoyl)oxy]butanoic acid | IUPAC |
| Homoserine, O-succinyl- | ChEBI |
| O-Succinylhomoserine | KEGG COMPOUND |