EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H18N4O2 |
| Net Charge | 0 |
| Average Mass | 202.258 |
| Monoisotopic Mass | 202.14298 |
| SMILES | CN(C)C(=N)NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C8H18N4O2/c1-12(2)8(10)11-5-3-4-6(9)7(13)14/h6H,3-5,9H2,1-2H3,(H2,10,11)(H,13,14)/t6-/m0/s1 |
| InChIKey | YDGMGEXADBMOMJ-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nω,Nω-dimethyl-L-arginine (CHEBI:17929) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| Nω,Nω-dimethyl-L-arginine (CHEBI:17929) is a L-arginine derivative (CHEBI:83965) |
| Nω,Nω-dimethyl-L-arginine (CHEBI:17929) is a dimethylarginine (CHEBI:86468) |
| Nω,Nω-dimethyl-L-arginine (CHEBI:17929) is a guanidines (CHEBI:24436) |
| Nω,Nω-dimethyl-L-arginine (CHEBI:17929) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Nω,Nω-dimethyl-L-arginine (CHEBI:17929) is conjugate base of Nω,Nω-dimethyl-L-argininium(1+) (CHEBI:58326) |
| Incoming Relation(s) |
| Nω,Nω-dimethyl-L-argininium(1+) (CHEBI:58326) is conjugate acid of Nω,Nω-dimethyl-L-arginine (CHEBI:17929) |
| Nω,Nω-dimethyl-L-arginine residue (CHEBI:61896) is substituent group from Nω,Nω-dimethyl-L-arginine (CHEBI:17929) |
| IUPAC Names |
|---|
| (2S)-2-amino-5-{[(dimethylamino)(imino)methyl]amino}pentanoic acid |
| (2S)-2-amino-5-(N',N'-dimethylcarbamimidamido)pentanoic acid |
| N5-[(dimethylamino)(imino)methyl]-L-ornithine |
| N5-(N,N-dimethylcarbamimidoyl)-L-ornithine |
| Synonyms | Source |
|---|---|
| ADMA | HMDB |
| asymmetric dimethylarginine | ChEBI |
| N,N-dimethylarginine | ChemIDplus |
| N5-((dimethylamino)iminomethyl)-L-ornithine | ChemIDplus |
| NG1,NG1-dimethylarginine | ChemIDplus |
| NG-dimethylarginine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2261521 | Beilstein |
| CAS:30315-93-6 | ChemIDplus |
| CAS:30315-93-6 | KEGG COMPOUND |