EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N5 |
| Net Charge | 0 |
| Average Mass | 203.249 |
| Monoisotopic Mass | 203.11710 |
| SMILES | CC(C)=CCNc1ncnc2ncnc12 |
| InChI | InChI=1S/C10H13N5/c1-7(2)3-4-11-9-8-10(13-5-12-8)15-6-14-9/h3,5-6H,4H2,1-2H3,(H2,11,12,13,14,15) |
| InChIKey | HYVABZIGRDEKCD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | cytokinin A phytohormone that promote cell division, or cytokinesis, in plant roots and shoots. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-dimethylallyladenine (CHEBI:17660) has role cytokinin (CHEBI:23530) |
| N6-dimethylallyladenine (CHEBI:17660) is a 6-isopentenylaminopurine (CHEBI:38643) |
| IUPAC Names |
|---|
| N-(3-methylbut-2-en-1-yl)-7H-purin-6-amine |
| N-(3-methylbut-2-en-1-yl)-9H-purin-6-amine |
| Synonyms | Source |
|---|---|
| (3-methyl-but-2-enyl)-(7(9)H-purin-6-yl)-amine | ChEBI |
| 6-(3-methyl-2-buten-1-ylamino)purine | ChEBI |
| 6-(gamma,gamma-Dimethylallylamino)purine | KEGG COMPOUND |
| N6-(Δ2-isopentenyl)adenine | ChemIDplus |
| iP | ChEBI |
| isopentenyl adenine | SUBMITTER |
| UniProt Name | Source |
|---|---|
| N6-dimethylallyladenine | UniProt |