EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO4 |
| Net Charge | 0 |
| Average Mass | 197.190 |
| Monoisotopic Mass | 197.06881 |
| SMILES | O=C(O)[C@H](Cc1ccc(O)cc1)NO |
| InChI | InChI=1S/C9H11NO4/c11-7-3-1-6(2-4-7)5-8(10-14)9(12)13/h1-4,8,10-11,14H,5H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | CNIUEVQJABPUIJ-QMMMGPOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS257) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-hydroxytyrosine (CHEBI:28089) is a N-hydroxy-α-amino-acid (CHEBI:50760) |
| N-hydroxytyrosine (CHEBI:28089) is a L-tyrosine derivative (CHEBI:27177) |
| N-hydroxytyrosine (CHEBI:28089) is conjugate acid of N-hydroxy-L-tyrosinate (CHEBI:58547) |
| Incoming Relation(s) |
| N-hydroxy-L-tyrosinate (CHEBI:58547) is conjugate base of N-hydroxytyrosine (CHEBI:28089) |
| IUPAC Name |
|---|
| N-hydroxy-L-tyrosine |
| Synonyms | Source |
|---|---|
| (2S)-2-(hydroxyamino)-3-(4-hydroxyphenyl)propanoic acid | IUPAC |
| hydroxy-L-tyrosine | ChEBI |
| hydroxytyrosine | ChEBI |
| N-Hydroxy-L-tyrosine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C03004 | KEGG COMPOUND |
| HMDB0038750 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14265538 | Reaxys |
| CAS:64448-49-3 | ChemIDplus |