EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11N5 |
| Net Charge | 0 |
| Average Mass | 225.255 |
| Monoisotopic Mass | 225.10145 |
| SMILES | c1ccc(CNc2ncnc3ncnc23)cc1 |
| InChI | InChI=1S/C12H11N5/c1-2-4-9(5-3-1)6-13-11-10-12(15-7-14-10)17-8-16-11/h1-5,7-8H,6H2,(H2,13,14,15,16,17) |
| InChIKey | NWBJYWHLCVSVIJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | cytokinin A phytohormone that promote cell division, or cytokinesis, in plant roots and shoots. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-benzyladenine (CHEBI:29022) has functional parent adenine (CHEBI:16708) |
| N-benzyladenine (CHEBI:29022) has role cytokinin (CHEBI:23530) |
| N-benzyladenine (CHEBI:29022) has role plant metabolite (CHEBI:76924) |
| N-benzyladenine (CHEBI:29022) is a 6-aminopurines (CHEBI:20706) |
| IUPAC Name |
|---|
| N-benzyl-9H-purin-6-amine |
| Synonyms | Source |
|---|---|
| 6-BAP | ChemIDplus |
| 6-Benzylaminopurine | KEGG COMPOUND |
| 6-(benzylamino)purine | NIST Chemistry WebBook |
| 6-[(phenylmethyl)amino]-9H-purine | NIST Chemistry WebBook |
| BAP | ChemIDplus |
| benzyladenine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1324 | BPDB |
| 6-Benzylaminopurine | Wikipedia |
| C00000092 | KNApSAcK |
| C11263 | KEGG COMPOUND |
| CPD-4604 | MetaCyc |
| EMU | PDBeChem |
| HMDB0039238 | HMDB |
| LSM-3396 | LINCS |
| Citations |
|---|