EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15NO6 |
| Net Charge | 0 |
| Average Mass | 221.209 |
| Monoisotopic Mass | 221.08994 |
| SMILES | [H]C(=O)[C@H](NC(C)=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H15NO6/c1-4(12)9-5(2-10)7(14)8(15)6(13)3-11/h2,5-8,11,13-15H,3H2,1H3,(H,9,12)/t5-,6+,7+,8+/m0/s1 |
| InChIKey | MBLBDJOUHNCFQT-LXGUWJNJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). EC 2.7.1.1 (hexokinase) inhibitor An EC 2.7.1.* (phosphotransferases with an alcohol group as acceptor) inhibitor that interferes with the action of hexokinase, EC 2.7.1.1, an enzyme that phosphorylates hexoses forming hexose phosphate. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aldehydo-N-acetyl-D-glucosamine (CHEBI:17411) has role human metabolite (CHEBI:77746) |
| aldehydo-N-acetyl-D-glucosamine (CHEBI:17411) is a N-acetylglucosamine (CHEBI:59640) |
| IUPAC Name |
|---|
| 2-acetamido-2-deoxy-D-glucose |
| Synonyms | Source |
|---|---|
| N-Acetyl-D-glucosamine | KEGG COMPOUND |
| N-Acetylchitosamine | KEGG COMPOUND |
| 2-Acetamido-2-deoxy-D-glucose | KEGG COMPOUND |
| D-GlcNAc | JCBN |
| Manual Xrefs | Databases |
|---|---|
| DB00141 | DrugBank |