EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14O6 |
| Net Charge | 0 |
| Average Mass | 182.172 |
| Monoisotopic Mass | 182.07904 |
| SMILES | OC[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[h2212h]/1/ |
| InChI | InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5-,6-/m0/s1 |
| InChIKey | FBPFZTCFMRRESA-FSIIMWSLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-glucitol (CHEBI:28789) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| L-glucitol (CHEBI:28789) is a glucitol (CHEBI:30911) |
| L-glucitol (CHEBI:28789) is enantiomer of D-glucitol (CHEBI:17924) |
| Incoming Relation(s) |
| D-glucitol (CHEBI:17924) is enantiomer of L-glucitol (CHEBI:28789) |
| IUPAC Name |
|---|
| L-glucitol |
| Synonyms | Source |
|---|---|
| L-Glucitol | KEGG COMPOUND |
| L-Sorbitol | KEGG COMPOUND |
| D-Gulitol | KEGG COMPOUND |
| L-sorbitol | ChEBI |
| D-gulitol | ChEBI |
| L-glucitol | ChEBI |
| UniProt Name | Source |
|---|---|
| L-glucitol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C01722 | KEGG COMPOUND |
| YMDB00724 | YMDB |
| ECMDB00247 | ECMDB |
| CPD-12810 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Gmelin:648560 | Gmelin |
| Reaxys:1721906 | Reaxys |
| CAS:6706-59-8 | KEGG COMPOUND |
| CAS:6706-59-8 | ChemIDplus |
| Citations |
|---|