EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO4 |
| Net Charge | 0 |
| Average Mass | 161.157 |
| Monoisotopic Mass | 161.06881 |
| SMILES | COC(=O)[C@@H](N)CCC(=O)O |
| InChI | InChI=1S/C6H11NO4/c1-11-6(10)4(7)2-3-5(8)9/h4H,2-3,7H2,1H3,(H,8,9)/t4-/m0/s1 |
| InChIKey | SEWIYICDCVPBEW-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-glutamate methyl ester (CHEBI:28575) is a L-glutamyl ester (CHEBI:21313) |
| L-glutamate methyl ester (CHEBI:28575) is a dicarboxylic acid monoester (CHEBI:36244) |
| L-glutamate methyl ester (CHEBI:28575) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| (4S)-4-amino-5-methoxy-5-oxopentanoic acid |
| Synonyms | Source |
|---|---|
| glutamic acid methyl ester | ChEBI |
| glutamic acid α-methyl ester | ChEBI |
| Glu(α-OMe)-OH | ChEBI |
| H-Glu-OMe | ChEBI |
| L-glutamate methylester | ChEBI |
| L-glutamic acid 1-methyl ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C05016 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1707273 | Reaxys |