EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N2O3 |
| Net Charge | 0 |
| Average Mass | 160.173 |
| Monoisotopic Mass | 160.08479 |
| SMILES | C[C@@H](N)C(=O)N[C@H](C)C(=O)O |
| InChI | InChI=1S/C6H12N2O3/c1-3(7)5(9)8-4(2)6(10)11/h3-4H,7H2,1-2H3,(H,8,9)(H,10,11)/t3-,4-/m1/s1 |
| InChIKey | DEFJQIDDEAULHB-QWWZWVQMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-alanyl-D-alanine (CHEBI:16576) has role Escherichia coli metabolite (CHEBI:76971) |
| D-alanyl-D-alanine (CHEBI:16576) is a dipeptide (CHEBI:46761) |
| D-alanyl-D-alanine (CHEBI:16576) is tautomer of D-alanyl-D-alanine zwitterion (CHEBI:57822) |
| Incoming Relation(s) |
| D-alanyl-D-alanine zwitterion (CHEBI:57822) is tautomer of D-alanyl-D-alanine (CHEBI:16576) |
| Synonyms | Source |
|---|---|
| D-Ala-D-Ala | KEGG COMPOUND |
| D-Alanyl-D-alanine | KEGG COMPOUND |
| H-D-Ala-D-Ala-OH | ChEBI |
| (D-Ala)2 | ChEBI |
| D-Ala-D-Ala | JCBN |
| Manual Xrefs | Databases |
|---|---|
| C00019576 | KNApSAcK |
| C00993 | KEGG COMPOUND |
| HMDB0003459 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1724814 | Reaxys |
| CAS:923-16-0 | KEGG COMPOUND |
| Citations |
|---|