EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9NO3 |
| Net Charge | 0 |
| Average Mass | 191.186 |
| Monoisotopic Mass | 191.05824 |
| SMILES | O=C(O)Cc1cnc2ccc(O)cc12 |
| InChI | InChI=1S/C10H9NO3/c12-7-1-2-9-8(4-7)6(5-11-9)3-10(13)14/h1-2,4-5,11-12H,3H2,(H,13,14) |
| InChIKey | DUUGKQCEGZLZNO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5-hydroxyindol-3-yl)acetic acid (CHEBI:27823) has role drug metabolite (CHEBI:49103) |
| (5-hydroxyindol-3-yl)acetic acid (CHEBI:27823) has role human metabolite (CHEBI:77746) |
| (5-hydroxyindol-3-yl)acetic acid (CHEBI:27823) has role mouse metabolite (CHEBI:75771) |
| (5-hydroxyindol-3-yl)acetic acid (CHEBI:27823) is a indole-3-acetic acids (CHEBI:24803) |
| (5-hydroxyindol-3-yl)acetic acid (CHEBI:27823) is conjugate acid of (5-hydroxyindol-3-yl)acetate (CHEBI:62622) |
| Incoming Relation(s) |
| 5-hydroxyindoleacetylglycine (CHEBI:27631) has functional parent (5-hydroxyindol-3-yl)acetic acid (CHEBI:27823) |
| (5-hydroxyindol-3-yl)acetate (CHEBI:62622) is conjugate base of (5-hydroxyindol-3-yl)acetic acid (CHEBI:27823) |
| IUPAC Name |
|---|
| (5-hydroxy-1H-indol-3-yl)acetic acid |
| Synonyms | Source |
|---|---|
| 5-Hydroxy-1H-indole-3-acetic acid | ChemIDplus |
| 5-Hydroxyindol-3-ylacetic acid | ChemIDplus |
| 5-Hydroxyindole-3-acetic acid | ChemIDplus |
| 5-Hydroxyindoleacetic acid | HMDB |
| 5-HIAA | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C05635 | KEGG COMPOUND |
| HMDB0000763 | HMDB |
| 5-Hydroxyindoleacetic_acid | Wikipedia |
| 5-HYDROXYINDOLE_ACETATE | MetaCyc |
| C00000104 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:168797 | Reaxys |
| CAS:54-16-0 | ChemIDplus |
| Citations |
|---|