EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10N3O3 |
| Net Charge | -1 |
| Average Mass | 172.164 |
| Monoisotopic Mass | 172.07276 |
| SMILES | N=C(N)NCCCC(=O)C(=O)[O-] |
| InChI | InChI=1S/C6H11N3O3/c7-6(8)9-3-1-2-4(10)5(11)12/h1-3H2,(H,11,12)(H4,7,8,9)/p-1 |
| InChIKey | ARBHXJXXVVHMET-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-guanidino-2-oxopentanoate (CHEBI:18253) has functional parent valerate (CHEBI:31011) |
| 5-guanidino-2-oxopentanoate (CHEBI:18253) is a 2-oxo monocarboxylic acid anion (CHEBI:35179) |
| 5-guanidino-2-oxopentanoate (CHEBI:18253) is conjugate base of 5-guanidino-2-oxopentanoic acid (CHEBI:28116) |
| Incoming Relation(s) |
| 5-guanidino-2-oxopentanoic acid (CHEBI:28116) is conjugate acid of 5-guanidino-2-oxopentanoate (CHEBI:18253) |
| IUPAC Name |
|---|
| 5-carbamimidamido-2-oxopentanoate |
| Synonyms | Source |
|---|---|
| 2-oxo-5-guanidino-pentanoate | ChEBI |
| 2-oxo-5-guanidinopentanoate | ChEBI |
| 5-guanidino-2-oxopentanoate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C03771 | KEGG COMPOUND |