EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO2 |
| Net Charge | 0 |
| Average Mass | 117.148 |
| Monoisotopic Mass | 117.07898 |
| SMILES | NCCCCC(=O)O |
| InChI | InChI=1S/C5H11NO2/c6-4-2-1-3-5(7)8/h1-4,6H2,(H,7,8) |
| InChIKey | JJMDCOVWQOJGCB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-aminopentanoic acid (CHEBI:15887) has functional parent valeric acid (CHEBI:17418) |
| 5-aminopentanoic acid (CHEBI:15887) has role human metabolite (CHEBI:77746) |
| 5-aminopentanoic acid (CHEBI:15887) is a δ-amino acid (CHEBI:35931) |
| 5-aminopentanoic acid (CHEBI:15887) is a ω-amino fatty acid (CHEBI:59758) |
| 5-aminopentanoic acid (CHEBI:15887) is conjugate acid of 5-aminopentanoate (CHEBI:86394) |
| 5-aminopentanoic acid (CHEBI:15887) is tautomer of 5-aminopentanoic acid zwitterion (CHEBI:356010) |
| Incoming Relation(s) |
| 5-acetamidopentanoic acid (CHEBI:2024) has functional parent 5-aminopentanoic acid (CHEBI:15887) |
| 5-aminopentanoate (CHEBI:86394) is conjugate base of 5-aminopentanoic acid (CHEBI:15887) |
| 5-aminopentanoic acid zwitterion (CHEBI:356010) is tautomer of 5-aminopentanoic acid (CHEBI:15887) |
| IUPAC Name |
|---|
| 5-aminopentanoic acid |
| Synonyms | Source |
|---|---|
| 5-Aminopentanoate | KEGG COMPOUND |
| 5-Aminopentanoic acid | KEGG COMPOUND |
| 5-Aminovaleric acid | KEGG COMPOUND |
| delta-Amino-n-valeric acid | ChemIDplus |
| 5-amino-n-valeric acid | ChEBI |
| δ-aminovaleric acid | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C00431 | KEGG COMPOUND |
| C00431 | KEGG COMPOUND |
| LMFA01100040 | LIPID MAPS |
| 5-AMINOPENTANOATE | MetaCyc |
| HMDB0003355 | HMDB |
| Citations |
|---|