EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O5 |
| Net Charge | 0 |
| Average Mass | 286.283 |
| Monoisotopic Mass | 286.08412 |
| SMILES | COc1ccc([C@@H]2CC(=O)c3c(O)cc(O)cc3O2)cc1 |
| InChI | InChI=1S/C16H14O5/c1-20-11-4-2-9(3-5-11)14-8-13(19)16-12(18)6-10(17)7-15(16)21-14/h2-7,14,17-18H,8H2,1H3/t14-/m0/s1 |
| InChIKey | HMUJXQRRKBLVOO-AWEZNQCLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4'-methoxy-5,7-dihydroxyflavanone (CHEBI:27552) has functional parent (S)-naringenin (CHEBI:17846) |
| 4'-methoxy-5,7-dihydroxyflavanone (CHEBI:27552) has role plant metabolite (CHEBI:76924) |
| 4'-methoxy-5,7-dihydroxyflavanone (CHEBI:27552) is a (2S)-flavan-4-one (CHEBI:140377) |
| 4'-methoxy-5,7-dihydroxyflavanone (CHEBI:27552) is a 4'-methoxyflavanones (CHEBI:140332) |
| 4'-methoxy-5,7-dihydroxyflavanone (CHEBI:27552) is a dihydroxyflavanone (CHEBI:38749) |
| 4'-methoxy-5,7-dihydroxyflavanone (CHEBI:27552) is a monomethoxyflavanone (CHEBI:38738) |
| Incoming Relation(s) |
| (2S)-poncirin (CHEBI:66773) has functional parent 4'-methoxy-5,7-dihydroxyflavanone (CHEBI:27552) |
| IUPAC Name |
|---|
| (2S)-5,7-dihydroxy-2-(4-methoxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| Isosakuranetin | KEGG COMPOUND |
| 4'-Methylnaringenin | KEGG COMPOUND |
| naringenin 4'-methyl ether | ChEBI |
| (S)-2,3-dihydro-5,7-dihydroxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (2S)-naringenin 4'-methyl ether | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C05334 | KEGG COMPOUND |
| LMPK12140355 | LIPID MAPS |
| Isosakuranetin | Wikipedia |
| C00000973 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:91627 | Reaxys |
| CAS:480-43-3 | KEGG COMPOUND |
| CAS:480-43-3 | ChemIDplus |
| Citations |
|---|