EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O2 |
| Net Charge | 0 |
| Average Mass | 136.150 |
| Monoisotopic Mass | 136.05243 |
| SMILES | CC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C8H8O2/c1-6(9)7-2-4-8(10)5-3-7/h2-5,10H,1H3 |
| InChIKey | TXFPEBPIARQUIG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4'-hydroxyacetophenone (CHEBI:28032) has role fungal metabolite (CHEBI:76946) |
| 4'-hydroxyacetophenone (CHEBI:28032) has role mouse metabolite (CHEBI:75771) |
| 4'-hydroxyacetophenone (CHEBI:28032) has role plant metabolite (CHEBI:76924) |
| 4'-hydroxyacetophenone (CHEBI:28032) is a monohydroxyacetophenone (CHEBI:25387) |
| Incoming Relation(s) |
| 4-acetylphenyl hydrogen sulfate (CHEBI:133226) has functional parent 4'-hydroxyacetophenone (CHEBI:28032) |
| IUPAC Name |
|---|
| 1-(4-hydroxyphenyl)ethanone |
| Synonyms | Source |
|---|---|
| 4-Acetylphenol | ChemIDplus |
| 4-Hydroxyacetophenone | ChemIDplus |
| 4'-Hydroxyacetophenone | KEGG COMPOUND |
| (4-hydroxyphenyl)ethan-1-one | ChEBI |
| (4-Hydroxyphenyl)ethan-1-one | KEGG COMPOUND |
| Methyl p-hydroxyphenyl ketone | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 4'-hydroxyacetophenone | UniProt |
| Citations |
|---|