EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O3 |
| Net Charge | 0 |
| Average Mass | 152.149 |
| Monoisotopic Mass | 152.04734 |
| SMILES | O=C(O)Cc1cccc(O)c1 |
| InChI | InChI=1S/C8H8O3/c9-7-3-1-2-6(4-7)5-8(10)11/h1-4,9H,5H2,(H,10,11) |
| InChIKey | FVMDYYGIDFPZAX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxyphenylacetic acid (CHEBI:17445) has functional parent acetic acid (CHEBI:15366) |
| 3-hydroxyphenylacetic acid (CHEBI:17445) has role human xenobiotic metabolite (CHEBI:76967) |
| 3-hydroxyphenylacetic acid (CHEBI:17445) is a monocarboxylic acid (CHEBI:25384) |
| 3-hydroxyphenylacetic acid (CHEBI:17445) is a phenols (CHEBI:33853) |
| 3-hydroxyphenylacetic acid (CHEBI:17445) is conjugate acid of 3-hydroxyphenylacetate (CHEBI:58149) |
| Incoming Relation(s) |
| 3-hydroxyphenylacetate (CHEBI:58149) is conjugate base of 3-hydroxyphenylacetic acid (CHEBI:17445) |
| IUPAC Name |
|---|
| (3-hydroxyphenyl)acetic acid |
| Synonyms | Source |
|---|---|
| 3-hydroxybenzeneacetic acid | ChemIDplus |
| 3-Hydroxyphenylacetic acid | KEGG COMPOUND |
| (m-hydroxyphenyl)acetic acid | ChemIDplus |
| m-hydroxyphenylacetic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 3HP | PDBeChem |
| 3-HYDROXYPHENYLACETATE | MetaCyc |
| C05593 | KEGG COMPOUND |
| HMDB0000440 | HMDB |
| US5639643 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2086506 | Reaxys |
| CAS:621-37-4 | KEGG COMPOUND |
| CAS:621-37-4 | ChemIDplus |
| Citations |
|---|