EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O3 |
| Net Charge | 0 |
| Average Mass | 102.089 |
| Monoisotopic Mass | 102.03169 |
| SMILES | CC(C=O)C(=O)O |
| InChI | InChI=1S/C4H6O3/c1-3(2-5)4(6)7/h2-3H,1H3,(H,6,7) |
| InChIKey | VOKUMXABRRXHAR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methyl-3-oxopropanoic acid (CHEBI:16256) has functional parent propionic acid (CHEBI:30768) |
| 2-methyl-3-oxopropanoic acid (CHEBI:16256) is a 3-oxo monocarboxylic acid (CHEBI:47881) |
| 2-methyl-3-oxopropanoic acid (CHEBI:16256) is a aldehyde (CHEBI:17478) |
| 2-methyl-3-oxopropanoic acid (CHEBI:16256) is conjugate acid of 2-methyl-3-oxopropanoate (CHEBI:57700) |
| Incoming Relation(s) |
| (S)-methylmalonaldehydic acid (CHEBI:27821) is a 2-methyl-3-oxopropanoic acid (CHEBI:16256) |
| (2R)-2-methyl-3-oxopropanoic acid (CHEBI:192476) is a 2-methyl-3-oxopropanoic acid (CHEBI:16256) |
| 2-methyl-3-oxopropanoate (CHEBI:57700) is conjugate base of 2-methyl-3-oxopropanoic acid (CHEBI:16256) |
| IUPAC Name |
|---|
| 2-methyl-3-oxopropanoic acid |
| Synonyms | Source |
|---|---|
| 2-Methyl-3-oxopropanoate | KEGG COMPOUND |
| 3-oxo-2-methylpropanoate | ChEBI |
| 3-Oxo-2-methylpropanoate | KEGG COMPOUND |
| Methylmalonate semialdehyde | KEGG COMPOUND |