EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24O3 |
| Net Charge | 0 |
| Average Mass | 288.387 |
| Monoisotopic Mass | 288.17254 |
| SMILES | [H][C@@]12CCc3cc(O)c(O)cc3[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C18H24O3/c1-18-7-6-11-12(14(18)4-5-17(18)21)3-2-10-8-15(19)16(20)9-13(10)11/h8-9,11-12,14,17,19-21H,2-7H2,1H3/t11-,12+,14-,17-,18-/m0/s1 |
| InChIKey | DILDHNKDVHLEQB-XSSYPUMDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| Application: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-17β-estradiol (CHEBI:28744) has functional parent 17β-estradiol (CHEBI:16469) |
| 2-hydroxy-17β-estradiol (CHEBI:28744) has role carcinogenic agent (CHEBI:50903) |
| 2-hydroxy-17β-estradiol (CHEBI:28744) has role human metabolite (CHEBI:77746) |
| 2-hydroxy-17β-estradiol (CHEBI:28744) has role metabolite (CHEBI:25212) |
| 2-hydroxy-17β-estradiol (CHEBI:28744) has role mouse metabolite (CHEBI:75771) |
| 2-hydroxy-17β-estradiol (CHEBI:28744) has role prodrug (CHEBI:50266) |
| 2-hydroxy-17β-estradiol (CHEBI:28744) is a 17β-hydroxy steroid (CHEBI:35343) |
| 2-hydroxy-17β-estradiol (CHEBI:28744) is a 2-hydroxy steroid (CHEBI:36857) |
| Incoming Relation(s) |
| 2-hydroxy-17β-estradiol 2-O-(β-D-glucuronide) (CHEBI:137907) has functional parent 2-hydroxy-17β-estradiol (CHEBI:28744) |
| 2-hydroxy-17β-estradiol 3-O-(β-D-glucuronide) (CHEBI:137837) has functional parent 2-hydroxy-17β-estradiol (CHEBI:28744) |
| 2-hydroxy-17β-estradiol 3-sulfate (CHEBI:136585) has functional parent 2-hydroxy-17β-estradiol (CHEBI:28744) |
| 2-hydroxy-17β-estradiol 3-sulfate(1−) (CHEBI:133942) has functional parent 2-hydroxy-17β-estradiol (CHEBI:28744) |
| IUPAC Name |
|---|
| estra-1,3,5(10)-triene-2,3,17β-triol |
| Synonyms | Source |
|---|---|
| (17β)-estra-1,3,5(10)-triene-2,3,17-triol | ChemIDplus |
| 2-Hydroxyestradiol-17beta | KEGG COMPOUND |
| 2-Hydroxyestradiol-17beta | KEGG COMPOUND |
| 2-OH-E2 | ChemIDplus |
| 2-OH-estradiol | ChemIDplus |
| 2-OH-Estradiol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 2-hydroxy-17β-estradiol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C05301 | KEGG COMPOUND |
| C05301 | KEGG COMPOUND |
| DB07706 | DrugBank |
| LMST02010027 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2219367 | Reaxys |
| CAS:362-05-0 | ChemIDplus |
| CAS:362-05-0 | KEGG COMPOUND |
| Citations |
|---|