EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O6 |
| Net Charge | 0 |
| Average Mass | 176.124 |
| Monoisotopic Mass | 176.03209 |
| SMILES | O=C(O)CCC(=O)C(O)C(=O)O |
| InChI | InChI=1S/C6H8O6/c7-3(1-2-4(8)9)5(10)6(11)12/h5,10H,1-2H2,(H,8,9)(H,11,12) |
| InChIKey | DVIFFQAOYQDXGL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-3-oxoadipic acid (CHEBI:16278) has functional parent adipic acid (CHEBI:30832) |
| 2-hydroxy-3-oxoadipic acid (CHEBI:16278) is a dicarboxylic fatty acid (CHEBI:189840) |
| 2-hydroxy-3-oxoadipic acid (CHEBI:16278) is a oxo dicarboxylic acid (CHEBI:36145) |
| 2-hydroxy-3-oxoadipic acid (CHEBI:16278) is a secondary α-hydroxy ketone (CHEBI:2468) |
| 2-hydroxy-3-oxoadipic acid (CHEBI:16278) is conjugate acid of 2-hydroxy-3-oxoadipate(2−) (CHEBI:57712) |
| Incoming Relation(s) |
| 2-hydroxy-3-oxoadipate(2−) (CHEBI:57712) is conjugate base of 2-hydroxy-3-oxoadipic acid (CHEBI:16278) |
| IUPAC Name |
|---|
| 2-hydroxy-3-oxohexanedioic acid |
| Synonym | Source |
|---|---|
| 2-Hydroxy-3-oxoadipate | KEGG COMPOUND |