EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O4 |
| Net Charge | 0 |
| Average Mass | 180.159 |
| Monoisotopic Mass | 180.04226 |
| SMILES | O=C(O)/C(O)=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C9H8O4/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-5,10-11H,(H,12,13)/b8-5- |
| InChIKey | GQYBCIHRWMPOOF-YVMONPNESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-3-(4-hydroxyphenyl)prop-2-enoic acid (CHEBI:27683) has functional parent acrylic acid (CHEBI:18308) |
| 2-hydroxy-3-(4-hydroxyphenyl)prop-2-enoic acid (CHEBI:27683) has role mouse metabolite (CHEBI:75771) |
| 2-hydroxy-3-(4-hydroxyphenyl)prop-2-enoic acid (CHEBI:27683) is a 2-hydroxy monocarboxylic acid (CHEBI:49302) |
| 2-hydroxy-3-(4-hydroxyphenyl)prop-2-enoic acid (CHEBI:27683) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2-hydroxy-3-(4-hydroxyphenyl)acrylic acid |
| Synonyms | Source |
|---|---|
| 4,α-dihydroxycinnamic acid | ChEBI |
| 2-hydroxy-3-(4-hydroxyphenyl)propenoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C05350 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2363632 | Reaxys |