EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N2O3 |
| Net Charge | 0 |
| Average Mass | 210.233 |
| Monoisotopic Mass | 210.10044 |
| SMILES | CNCCCC(=O)c1ccc(O)nc1O |
| InChI | InChI=1S/C10H14N2O3/c1-11-6-2-3-8(13)7-4-5-9(14)12-10(7)15/h4-5,11H,2-3,6H2,1H3,(H2,12,14,15) |
| InChIKey | JJJLAXLRPLCXNT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dihydroxypseudooxynicotine (CHEBI:28220) has functional parent pseudooxynicotine (CHEBI:37753) |
| 2,6-dihydroxypseudooxynicotine (CHEBI:28220) is a aromatic ketone (CHEBI:76224) |
| 2,6-dihydroxypseudooxynicotine (CHEBI:28220) is a dihydroxypyridine (CHEBI:23793) |
| 2,6-dihydroxypseudooxynicotine (CHEBI:28220) is a secondary amino compound (CHEBI:50995) |
| 2,6-dihydroxypseudooxynicotine (CHEBI:28220) is conjugate base of 2,6-dihydroxypseudooxynicotinium(1+) (CHEBI:66944) |
| Incoming Relation(s) |
| 2,6-dihydroxypseudooxynicotinium(1+) (CHEBI:66944) is conjugate acid of 2,6-dihydroxypseudooxynicotine (CHEBI:28220) |
| IUPAC Name |
|---|
| 1-(2,6-dihydroxypyridin-3-yl)-4-(methylamino)butan-1-one |