EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H30MgN4O5 |
| Net Charge | 0 |
| Average Mass | 610.953 |
| Monoisotopic Mass | 610.20666 |
| SMILES | C=CC1=C(C)C2=[N+]3C1=Cc1c(C)c4c5[n]1[Mg-2]31[n]3c(c(C)c(C=C)c3=C2)=CC2=[N+]1C(=C5[C@@H](C(=O)OC)C4=O)C(CCC(=O)O)=C2C |
| InChI | InChI=1S/C35H32N4O5.Mg/c1-8-19-15(3)22-12-24-17(5)21(10-11-28(40)41)32(38-24)30-31(35(43)44-7)34(42)29-18(6)25(39-33(29)30)14-27-20(9-2)16(4)23(37-27)13-26(19)36-22;/h8-9,12-14,31H,1-2,10-11H2,3-7H3,(H3,36,37,38,39,40,41,42);/q;+2/p-2/b22-12-,23-13-,24-12-,25-14-,26-13-,27-14-,32-30-;/t31-;/m1./s1 |
| InChIKey | YXBIPIDDNARELO-KKNVGXODSA-L |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-divinyl protochlorophyllide a (CHEBI:30619) is a dicarboxylic acid monoester (CHEBI:36244) |
| 2,4-divinyl protochlorophyllide a (CHEBI:30619) is a methyl ester (CHEBI:25248) |
| 2,4-divinyl protochlorophyllide a (CHEBI:30619) is a protochlorophyllides (CHEBI:26354) |
| 2,4-divinyl protochlorophyllide a (CHEBI:30619) is conjugate acid of 2,4-divinyl protochlorophyllide a(1−) (CHEBI:77667) |
| 2,4-divinyl protochlorophyllide a (CHEBI:30619) is conjugate acid of 2,4-divinyl protochlorophyllide a(2−) (CHEBI:58632) |
| Incoming Relation(s) |
| 2,4-divinyl protochlorophyllide a(1−) (CHEBI:77667) is conjugate base of 2,4-divinyl protochlorophyllide a (CHEBI:30619) |
| 2,4-divinyl protochlorophyllide a(2−) (CHEBI:58632) is conjugate base of 2,4-divinyl protochlorophyllide a (CHEBI:30619) |
| IUPAC Name |
|---|
| {3-[(21R)-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-9,14-divinyl-3,4-didehydrophorbin-3-yl-κ4N23,N24,N25,N26]propanoato(2−)}magnesium |
| Synonyms | Source |
|---|---|
| Divinylprotochlorophyllide | KEGG COMPOUND |
| 2,4-Divinylprotochlorophyllide | KEGG COMPOUND |
| Mg-2,4-Divinyl-phaeoporphyrin a5-monomethylester | KEGG COMPOUND |
| Mg-2,4-Divinylpheoporphyrin | ChemIDplus |
| Divinyl protochlorophyllide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C11831 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7511448 | Beilstein |
| CAS:18433-30-2 | KEGG COMPOUND |
| CAS:18433-30-2 | ChemIDplus |