EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17405 - 4-pyridoxic acid
| Formula | C8H9NO4 |
| Net Charge | 0 |
| Average Mass | 183.163 |
| Monoisotopic Mass | 183.05316 |
| SMILES | Cc1ncc(CO)c(C(=O)O)c1O |
| InChI | InChI=1S/C8H9NO4/c1-4-7(11)6(8(12)13)5(3-10)2-9-4/h2,10-11H,3H2,1H3,(H,12,13) |
| InChIKey | HXACOUQIXZGNBF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| urine (BTO:0001419) | PubMed (18230968) | ||
| - | MetaboLights (MTBLS404) | From MetaboLights | |
| saliva (UBERON:0001836) | Article (Dame, ZT. et al. (2014) The Human Saliva Metabolome (manuscript in preparation)) | ||
| - | PubMed (8505768) | ||
| blood (UBERON:0000178) | PubMed (15450810) | ||
| - | MetaboLights (MTBLS290) | From MetaboLights | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-pyridoxic acid (CHEBI:17405) has functional parent isonicotinic acid (CHEBI:6032) |
| 4-pyridoxic acid (CHEBI:17405) has role human urinary metabolite (CHEBI:84087) |
| 4-pyridoxic acid (CHEBI:17405) has role mouse metabolite (CHEBI:75771) |
| 4-pyridoxic acid (CHEBI:17405) is a hydroxymethylpyridine (CHEBI:38196) |
| 4-pyridoxic acid (CHEBI:17405) is a methylpyridines (CHEBI:25340) |
| 4-pyridoxic acid (CHEBI:17405) is a monohydroxypyridine (CHEBI:38182) |
| 4-pyridoxic acid (CHEBI:17405) is a vitamin B6 (CHEBI:27306) |
| 4-pyridoxic acid (CHEBI:17405) is conjugate acid of 4-pyridoxate (CHEBI:30959) |
| Incoming Relation(s) |
| 4-pyridoxolactone (CHEBI:16871) has functional parent 4-pyridoxic acid (CHEBI:17405) |
| 4-pyridoxate (CHEBI:30959) is conjugate base of 4-pyridoxic acid (CHEBI:17405) |
| IUPAC Name |
|---|
| 3-hydroxy-5-(hydroxymethyl)-2-methylpyridine-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| 2-methyl-3-hydroxy-4-carboxy-5-hydroxymethylpyridine | ChemIDplus |
| 3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinecarboxylic acid | ChemIDplus |
| 3-hydroxy-5-(hydroxymethyl)-2-methylisonicotinic acid | ChemIDplus |
| 4-Pyridoxic acid | KEGG COMPOUND |
| 4-pyridoxinecarboxylic acid | ChemIDplus |
| 4-pyridoxinic acid | ChemIDplus |
| Citations |
|---|