EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8NO7P |
| Net Charge | 0 |
| Average Mass | 213.082 |
| Monoisotopic Mass | 213.00384 |
| SMILES | N[C@@H](CC(=O)OP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C4H8NO7P/c5-2(4(7)8)1-3(6)12-13(9,10)11/h2H,1,5H2,(H,7,8)(H2,9,10,11)/t2-/m0/s1 |
| InChIKey | IXZNKTPIYKDIGG-REOHCLBHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-phospho-L-aspartic acid (CHEBI:15836) has role Escherichia coli metabolite (CHEBI:76971) |
| 4-phospho-L-aspartic acid (CHEBI:15836) is a L-aspartic acid derivative (CHEBI:83978) |
| 4-phospho-L-aspartic acid (CHEBI:15836) is a aminoacyl phosphate (CHEBI:36951) |
| 4-phospho-L-aspartic acid (CHEBI:15836) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 4-phospho-L-aspartic acid (CHEBI:15836) is conjugate acid of 4-phospho-L-aspartate (CHEBI:30407) |
| 4-phospho-L-aspartic acid (CHEBI:15836) is conjugate acid of 4-phosphonato-L-aspartic acid(2−) (CHEBI:57535) |
| Incoming Relation(s) |
| 4-phospho-L-aspartate (CHEBI:30407) is conjugate base of 4-phospho-L-aspartic acid (CHEBI:15836) |
| 4-phosphonato-L-aspartic acid(2−) (CHEBI:57535) is conjugate base of 4-phospho-L-aspartic acid (CHEBI:15836) |
| 4-phospho-L-aspartic acid residue (CHEBI:137319) is substituent group from 4-phospho-L-aspartic acid (CHEBI:15836) |
| IUPAC Names |
|---|
| 4-oxo-O-phosphono-L-homoserine |
| (2S)-2-amino-4-oxo-4-(phosphonooxy)butanoic acid |
| L-β-aspartyl dihydrogen phosphate |
| Synonyms | Source |
|---|---|
| L-4-Aspartyl phosphate | KEGG COMPOUND |
| 4-phospho-L-aspartic acid | ChEBI |
| L-aspart-4-yl phosphate | ChEBI |