EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O3 |
| Net Charge | 0 |
| Average Mass | 130.143 |
| Monoisotopic Mass | 130.06299 |
| SMILES | CC(C)CC(=O)C(=O)O |
| InChI | InChI=1S/C6H10O3/c1-4(2)3-5(7)6(8)9/h4H,3H2,1-2H3,(H,8,9) |
| InChIKey | BKAJNAXTPSGJCU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (14636955) | |
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methyl-2-oxopentanoic acid (CHEBI:48430) has functional parent valeric acid (CHEBI:17418) |
| 4-methyl-2-oxopentanoic acid (CHEBI:48430) has role algal metabolite (CHEBI:84735) |
| 4-methyl-2-oxopentanoic acid (CHEBI:48430) has role human metabolite (CHEBI:77746) |
| 4-methyl-2-oxopentanoic acid (CHEBI:48430) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 4-methyl-2-oxopentanoic acid (CHEBI:48430) is a branched-chain keto acid (CHEBI:191197) |
| 4-methyl-2-oxopentanoic acid (CHEBI:48430) is conjugate acid of 4-methyl-2-oxopentanoate (CHEBI:17865) |
| Incoming Relation(s) |
| 4-methyl-2-oxopentanoate (CHEBI:17865) is conjugate base of 4-methyl-2-oxopentanoic acid (CHEBI:48430) |
| IUPAC Name |
|---|
| 4-methyl-2-oxopentanoic acid |
| Synonyms | Source |
|---|---|
| 4-Methyl-2-oxopentanoate | KEGG COMPOUND |
| 2-Oxoisocaproate | KEGG COMPOUND |
| 2-OXO-4-METHYLPENTANOIC ACID | PDBeChem |
| α-ketoisocaproic acid | ChemIDplus |
| 4-methyl-2-oxovaleric acid | ChemIDplus |
| Ketoleucine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C00233 | KEGG COMPOUND |
| COI | PDBeChem |
| DB03229 | DrugBank |
| HMDB0000695 | HMDB |
| 2K-4CH3-PENTANOATE | MetaCyc |
| C00019677 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1701823 | Reaxys |
| CAS:816-66-0 | ChemIDplus |
| CAS:816-66-0 | KEGG COMPOUND |
| Citations |
|---|