EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11O4 |
| Net Charge | -1 |
| Average Mass | 147.150 |
| Monoisotopic Mass | 147.06628 |
| SMILES | CC(C)(CO)[C@@H](O)C(=O)[O-] |
| InChI | InChI=1S/C6H12O4/c1-6(2,3-7)4(8)5(9)10/h4,7-8H,3H2,1-2H3,(H,9,10)/p-1/t4-/m0/s1 |
| InChIKey | OTOIIPJYVQJATP-BYPYZUCNSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-pantoate (CHEBI:15980) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| (R)-pantoate (CHEBI:15980) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| (R)-pantoate (CHEBI:15980) is conjugate base of (R)-pantoic acid (CHEBI:18697) |
| Incoming Relation(s) |
| (R)-pantoic acid (CHEBI:18697) is conjugate acid of (R)-pantoate (CHEBI:15980) |
| IUPAC Name |
|---|
| (2R)-2,4-dihydroxy-3,3-dimethylbutanoate |
| Synonyms | Source |
|---|---|
| PANTOATE | PDBeChem |
| (R)-Pantoate | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (R)-pantoate | UniProt |