EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16654 - (R)-4-dehydropantoic acid
| Formula | C6H10O4 |
| Net Charge | 0 |
| Average Mass | 146.142 |
| Monoisotopic Mass | 146.05791 |
| SMILES | [H]C(=O)C(C)(C)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C6H10O4/c1-6(2,3-7)4(8)5(9)10/h3-4,8H,1-2H3,(H,9,10)/t4-/m0/s1 |
| InChIKey | HVMPYIKTQSOMHA-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-4-dehydropantoic acid (CHEBI:16654) has functional parent (R)-pantoic acid (CHEBI:18697) |
| (R)-4-dehydropantoic acid (CHEBI:16654) is a 2-hydroxy monocarboxylic acid (CHEBI:49302) |
| (R)-4-dehydropantoic acid (CHEBI:16654) is a aldehyde (CHEBI:17478) |
| (R)-4-dehydropantoic acid (CHEBI:16654) is conjugate acid of (R)-4-dehydropantoate (CHEBI:57849) |
| Incoming Relation(s) |
| (R)-4-dehydropantoate (CHEBI:57849) is conjugate base of (R)-4-dehydropantoic acid (CHEBI:16654) |
| IUPAC Name |
|---|
| (2R)-2-hydroxy-3,3-dimethyl-4-oxobutanoic acid |
| Synonyms | Source |
|---|---|
| (R)-4-Dehydropantoate | KEGG COMPOUND |
| (R)-4-dehydropantoate | ChEBI |