EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O2 |
| Net Charge | 0 |
| Average Mass | 148.161 |
| Monoisotopic Mass | 148.05243 |
| SMILES | [H]C(=O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C9H8O2/c10-7-1-2-8-3-5-9(11)6-4-8/h1-7,11H/b2-1+ |
| InChIKey | CJXMVKYNVIGQBS-OWOJBTEDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alpinia galanga (ncbitaxon:94327) | rhizome (BTO:0001181) | PubMed (15930771) |
| Roles Classification |
|---|
| Biological Roles: | EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxycinnamaldehyde (CHEBI:28353) has functional parent (E)-cinnamaldehyde (CHEBI:16731) |
| 4-hydroxycinnamaldehyde (CHEBI:28353) has role apoptosis inducer (CHEBI:68495) |
| 4-hydroxycinnamaldehyde (CHEBI:28353) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| 4-hydroxycinnamaldehyde (CHEBI:28353) has role plant metabolite (CHEBI:76924) |
| 4-hydroxycinnamaldehyde (CHEBI:28353) is a cinnamaldehydes (CHEBI:23245) |
| IUPAC Name |
|---|
| (2E)-3-(4-hydroxyphenyl)prop-2-enal |
| Synonyms | Source |
|---|---|
| (2E)-3-(4-hydroxyphenyl)acrylaldehyde | IUPAC |
| 4-Hydroxycinnamyl aldehyde | KEGG COMPOUND |
| p-hydroxycinnamaldehyde | ChEBI |
| trans-4-hydroxycinnamaldehyde | ChEBI |
| p-Coumaraldehyde | KEGG COMPOUND |
| trans-p-Hydroxycinnamaldehyde | HMDB |
| UniProt Name | Source |
|---|---|
| (E)-4-coumaraldehyde | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C05608 | KEGG COMPOUND |
| COUMARALDEHYDE | MetaCyc |
| HMDB0040986 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2242678 | Reaxys |
| CAS:2538-87-6 | KEGG COMPOUND |
| Citations |
|---|