EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O5 |
| Net Charge | 0 |
| Average Mass | 272.256 |
| Monoisotopic Mass | 272.06847 |
| SMILES | [H][C@@]12Oc3cc(O)ccc3[C@]1(O)COc1cc(O)ccc12 |
| InChI | InChI=1S/C15H12O5/c16-8-1-3-10-12(5-8)19-7-15(18)11-4-2-9(17)6-13(11)20-14(10)15/h1-6,14,16-18H,7H2/t14-,15+/m0/s1 |
| InChIKey | QMXOFBXZEKTJIK-LSDHHAIUSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. phytoestrogen Any compound produced by a plant that happens to have estrogenic activity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,6,9-trihydroxypterocarpan (CHEBI:15649) has role antibacterial agent (CHEBI:33282) |
| 3,6,9-trihydroxypterocarpan (CHEBI:15649) has role antimicrobial agent (CHEBI:33281) |
| 3,6,9-trihydroxypterocarpan (CHEBI:15649) has role phytoestrogen (CHEBI:76989) |
| 3,6,9-trihydroxypterocarpan (CHEBI:15649) has role plant metabolite (CHEBI:76924) |
| 3,6,9-trihydroxypterocarpan (CHEBI:15649) is a pterocarpans (CHEBI:26377) |
| Incoming Relation(s) |
| (6aS,11aS)-2-dimethylallyl-3,6a,9-trihydroxypterocarpan (CHEBI:50118) has functional parent 3,6,9-trihydroxypterocarpan (CHEBI:15649) |
| (6aS,11aS)-4-dimethylallyl-3,6a,9-trihydroxypterocarpan (CHEBI:50036) has functional parent 3,6,9-trihydroxypterocarpan (CHEBI:15649) |
| IUPAC Name |
|---|
| (6aS,11aS)-6a,11a-dihydro-6H-benzo[4,5]furo[3,2-c]chromene-3,6a,9-triol |
| Synonyms | Source |
|---|---|
| 3,6,9-Trihydroxypterocarpan | KEGG COMPOUND |
| (6alphaS,11alphaS)-3,6alpha,9-trihydroxypterocarpan | HMDB |
| (6aS,11aS)-3,6a,9-Trihydroxypterocarpan | KEGG COMPOUND |
| (6aS-cis)-6H-Benzofuro(3,2-c)(1)benzopyran-3,6a,9(11aH)-triol | ChemIDplus |
| 6H-Benzofuro[3,2-c][1]benzopyran-3,6a,9(11aH)-triol | HMDB |
| (-)-Glycinol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (6aS,11aS)-3,6a,9-trihydroxypterocarpan | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 6AS11AS-36A9-TRIHYDROXYPTEROCARPAN | MetaCyc |
| C00002532 | KNApSAcK |
| C01263 | KEGG COMPOUND |
| HMDB0034105 | HMDB |
| LMPK12070128 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1259301 | Reaxys |
| CAS:69393-95-9 | KEGG COMPOUND |
| CAS:69393-95-9 | ChemIDplus |
| Citations |
|---|